C30H52O3 — CID 174872742
[(1S,2R,4aR,6aR,6aS,6bR,8aS,12aS,14aR,14bS)-14-hydroxy-1,2,4a,6b,9,9,12a-heptamethyl-2,3,4,5,6,6a,7,8,8a,10,11,12,13,14,14a,14b-hexadecahydro-1H-picen-6a-yl]methanediol (PubChem CID 174872742) has the molecular formula C30H52O3 and a molecular weight of 460.74 g/mol. Its IUPAC name is [(1S,2R,4aR,6aR,6aS,6bR,8aS,12aS,14aR,14bS)-14-hydroxy-1,2,4a,6b,9,9,12a-heptamethyl-2,3,4,5,6,6a,7,8,8a,10,11,12,13,14,14a,14b-hexadecahydro-1H-picen-6a-yl]methanediol.
| Compound Name | [(1S,2R,4aR,6aR,6aS,6bR,8aS,12aS,14aR,14bS)-14-hydroxy-1,2,4a,6b,9,9,12a-heptamethyl-2,3,4,5,6,6a,7,8,8a,10,11,12,13,14,14a,14b-hexadecahydro-1H-picen-6a-yl]methanediol |
|---|---|
| PubChem CID | 174872742 |
| Molecular Formula | C30H52O3 |
| Molecular Weight | 460.74 g/mol |
| Exact Mass | 460.39 |
| IUPAC Name | [(1S,2R,4aR,6aR,6aS,6bR,8aS,12aS,14aR,14bS)-14-hydroxy-1,2,4a,6b,9,9,12a-heptamethyl-2,3,4,5,6,6a,7,8,8a,10,11,12,13,14,14a,14b-hexadecahydro-1H-picen-6a-yl]methanediol |
| SMILES | C[C@@H]1[C@H]2[C@H]3C(O)C[C@@H]4[C@@]5(C)CCCC(C)(C)[C@@H]5CC[C@@]4(C)[C@]3(C(O)O)CC[C@@]2(C)CC[C@H]1C |
| InChI | InChI=1S/C30H52O3/c1-18-9-13-27(5)15-16-30(25(32)33)24(23(27)19(18)2)20(31)17-22-28(6)12-8-11-26(3,4)21(28)10-14-29(22,30)7/h18-25,31-33H,8-17H2,1-7H3/t18-,19+,20?,21+,22-,23+,24-,27-,28+,29-,30-/m1/s1 |
| InChIKey | UYDVVKUIOBYGTL-AKYHZDSQSA-N |
| XLogP | 6.40 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.74 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|