C18H32N2O5 — CID 174873297
(Z)-6,12-dihydroxy-7,13-dinitrosooctadec-9-enal (PubChem CID 174873297) has the molecular formula C18H32N2O5 and a molecular weight of 356.46 g/mol. Its IUPAC name is (Z)-6,12-dihydroxy-7,13-dinitrosooctadec-9-enal.
| Compound Name | (Z)-6,12-dihydroxy-7,13-dinitrosooctadec-9-enal |
|---|---|
| PubChem CID | 174873297 |
| Molecular Formula | C18H32N2O5 |
| Molecular Weight | 356.46 g/mol |
| Exact Mass | 356.23 |
| IUPAC Name | (Z)-6,12-dihydroxy-7,13-dinitrosooctadec-9-enal |
| SMILES | CCCCCC(N=O)C(O)C/C=C\CC(N=O)C(O)CCCCC=O |
| InChI | InChI=1S/C18H32N2O5/c1-2-3-5-10-15(19-24)18(23)13-8-7-11-16(20-25)17(22)12-6-4-9-14-21/h7-8,14-18,22-23H,2-6,9-13H2,1H3/b8-7- |
| InChIKey | XTPNAOWBDCHGIX-FPLPWBNLSA-N |
| XLogP | 3.65 |
| TPSA | 116.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.46 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|