About 4-(2-hydroxyphenyl)butyl carbamodithioate
4-(2-hydroxyphenyl)butyl carbamodithioate (PubChem CID 174875461) has the molecular formula C11H15NOS2
and a molecular weight of 241.38 g/mol. Its IUPAC name is 4-(2-hydroxyphenyl)butyl carbamodithioate.
Molecular Properties
| Compound Name | 4-(2-hydroxyphenyl)butyl carbamodithioate |
| PubChem CID | 174875461 |
| Molecular Formula | C11H15NOS2 |
| Molecular Weight | 241.38 g/mol |
| Exact Mass | 241.06 |
| IUPAC Name | 4-(2-hydroxyphenyl)butyl carbamodithioate |
| SMILES | NC(=S)SCCCCc1ccccc1O |
| InChI | InChI=1S/C11H15NOS2/c12-11(14)15-8-4-3-6-9-5-1-2-7-10(9)13/h1-2,5,7,13H,3-4,6,8H2,(H2,12,14) |
| InChIKey | FOGHTJFRNYIAKK-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.38 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 4-(2-hydroxyphenyl)butyl carbamodithioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-hydroxyphenyl)butyl carbamodithioate?
The IUPAC name of 4-(2-hydroxyphenyl)butyl carbamodithioate (CID 174875461) is 4-(2-hydroxyphenyl)butyl carbamodithioate.
What is the SMILES notation for 4-(2-hydroxyphenyl)butyl carbamodithioate?
The canonical SMILES for 4-(2-hydroxyphenyl)butyl carbamodithioate is NC(=S)SCCCCc1ccccc1O.
What is the InChIKey of 4-(2-hydroxyphenyl)butyl carbamodithioate?
The InChIKey is FOGHTJFRNYIAKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NOS2/c12-11(14)15-8-4-3-6-9-5-1-2-7-10(9)13/h1-2,5,7,13H,3-4,6,8H2,(H2,12,14).
What are the key properties of 4-(2-hydroxyphenyl)butyl carbamodithioate?
4-(2-hydroxyphenyl)butyl carbamodithioate has a molecular weight of 241.38 g/mol, XLogP of 2.69, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-hydroxyphenyl)butyl carbamodithioate is sourced from PubChem (CID 174875461), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).