C8H8ClIN2O4 — CID 174882632
3-chloropyrrolidine-2,5-dione;1-iodopyrrolidine-2,5-dione (PubChem CID 174882632) has the molecular formula C8H8ClIN2O4 and a molecular weight of 358.52 g/mol. Its IUPAC name is 3-chloropyrrolidine-2,5-dione;1-iodopyrrolidine-2,5-dione.
| Compound Name | 3-chloropyrrolidine-2,5-dione;1-iodopyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 174882632 |
| Molecular Formula | C8H8ClIN2O4 |
| Molecular Weight | 358.52 g/mol |
| Exact Mass | 357.92 |
| IUPAC Name | 3-chloropyrrolidine-2,5-dione;1-iodopyrrolidine-2,5-dione |
| SMILES | O=C1CC(Cl)C(=O)N1.O=C1CCC(=O)N1I |
| InChI | InChI=1S/C4H4ClNO2.C4H4INO2/c5-2-1-3(7)6-4(2)8;5-6-3(7)1-2-4(6)8/h2H,1H2,(H,6,7,8);1-2H2 |
| InChIKey | SUAXYPRAEWFEIY-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.52 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|