About 1-butylsulfanylbutane;tributylphosphane
1-butylsulfanylbutane;tributylphosphane (PubChem CID 174884849) has the molecular formula C20H45PS
and a molecular weight of 348.62 g/mol. Its IUPAC name is 1-butylsulfanylbutane;tributylphosphane.
Molecular Properties
| Compound Name | 1-butylsulfanylbutane;tributylphosphane |
| PubChem CID | 174884849 |
| Molecular Formula | C20H45PS |
| Molecular Weight | 348.62 g/mol |
| Exact Mass | 348.30 |
| IUPAC Name | 1-butylsulfanylbutane;tributylphosphane |
| SMILES | CCCCP(CCCC)CCCC.CCCCSCCCC |
| InChI | InChI=1S/C12H27P.C8H18S/c1-4-7-10-13(11-8-5-2)12-9-6-3;1-3-5-7-9-8-6-4-2/h4-12H2,1-3H3;3-8H2,1-2H3 |
| InChIKey | JUFYRKVJZHSZGN-UHFFFAOYSA-N |
| XLogP | 8.19 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 348.62 |
| LogP ≤ 5 | 8.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 1-butylsulfanylbutane;tributylphosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butylsulfanylbutane;tributylphosphane?
The IUPAC name of 1-butylsulfanylbutane;tributylphosphane (CID 174884849) is 1-butylsulfanylbutane;tributylphosphane.
What is the SMILES notation for 1-butylsulfanylbutane;tributylphosphane?
The canonical SMILES for 1-butylsulfanylbutane;tributylphosphane is CCCCP(CCCC)CCCC.CCCCSCCCC.
What is the InChIKey of 1-butylsulfanylbutane;tributylphosphane?
The InChIKey is JUFYRKVJZHSZGN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H27P.C8H18S/c1-4-7-10-13(11-8-5-2)12-9-6-3;1-3-5-7-9-8-6-4-2/h4-12H2,1-3H3;3-8H2,1-2H3.
What are the key properties of 1-butylsulfanylbutane;tributylphosphane?
1-butylsulfanylbutane;tributylphosphane has a molecular weight of 348.62 g/mol, XLogP of 8.19, 15 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butylsulfanylbutane;tributylphosphane is sourced from PubChem (CID 174884849), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).