C8H11FO6 — CID 174899999
carbonic acid;1-fluoroprop-1-ene;oxolane-2,5-dione (PubChem CID 174899999) has the molecular formula C8H11FO6 and a molecular weight of 222.17 g/mol. Its IUPAC name is carbonic acid;1-fluoroprop-1-ene;oxolane-2,5-dione.
| Compound Name | carbonic acid;1-fluoroprop-1-ene;oxolane-2,5-dione |
|---|---|
| PubChem CID | 174899999 |
| Molecular Formula | C8H11FO6 |
| Molecular Weight | 222.17 g/mol |
| Exact Mass | 222.05 |
| IUPAC Name | carbonic acid;1-fluoroprop-1-ene;oxolane-2,5-dione |
| SMILES | CC=CF.O=C(O)O.O=C1CCC(=O)O1 |
| InChI | InChI=1S/C4H4O3.C3H5F.CH2O3/c5-3-1-2-4(6)7-3;1-2-3-4;2-1(3)4/h1-2H2;2-3H,1H3;(H2,2,3,4) |
| InChIKey | OUNQOVNSUHFCNG-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.17 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|