C24H22N4OZn — CID 174913357
21,22-dihydroporphyrin;oxolane;zinc (PubChem CID 174913357) has the molecular formula C24H22N4OZn and a molecular weight of 447.86 g/mol. Its IUPAC name is 21,22-dihydroporphyrin;oxolane;zinc.
| Compound Name | 21,22-dihydroporphyrin;oxolane;zinc |
|---|---|
| PubChem CID | 174913357 |
| Molecular Formula | C24H22N4OZn |
| Molecular Weight | 447.86 g/mol |
| Exact Mass | 446.11 |
| IUPAC Name | 21,22-dihydroporphyrin;oxolane;zinc |
| SMILES | C1=Cc2cc3ccc(cc4ccc(cc5nc(cc1n2)C=C5)[nH]4)[nH]3.C1CCOC1.[Zn] |
| InChI | InChI=1S/C20H14N4.C4H8O.Zn/c1-2-14-10-16-5-6-18(23-16)12-20-8-7-19(24-20)11-17-4-3-15(22-17)9-13(1)21-14;1-2-4-5-3-1;/h1-12,21-22H;1-4H2;/b13-9-,14-10-,15-9-,16-10-,17-11-,18-12-,19-11-,20-12-;; |
| InChIKey | LBDQPKCROLFGAJ-IAULSPAKSA-N |
| XLogP | 5.45 |
| TPSA | 66.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.86 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|