C10H11NO2S2 — CID 174933690
ethyl formate;5-thiophen-2-yl-1,3-thiazole (PubChem CID 174933690) has the molecular formula C10H11NO2S2 and a molecular weight of 241.34 g/mol. Its IUPAC name is ethyl formate;5-thiophen-2-yl-1,3-thiazole.
| Compound Name | ethyl formate;5-thiophen-2-yl-1,3-thiazole |
|---|---|
| PubChem CID | 174933690 |
| Molecular Formula | C10H11NO2S2 |
| Molecular Weight | 241.34 g/mol |
| Exact Mass | 241.02 |
| IUPAC Name | ethyl formate;5-thiophen-2-yl-1,3-thiazole |
| SMILES | CCOC=O.c1csc(-c2cncs2)c1 |
| InChI | InChI=1S/C7H5NS2.C3H6O2/c1-2-6(9-3-1)7-4-8-5-10-7;1-2-5-3-4/h1-5H;3H,2H2,1H3 |
| InChIKey | WWDYROTXAAPZTG-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.34 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|