amino N-amino-N-carbamoyloxycarbamate

C2H6N4O4 — CID 174934503

IUPACamino N-amino-N-carbamoyloxycarbamate
SMILESNOC(=O)N(N)OC(N)=O
InChIInChI=1S/C2H6N4O4/c3-1(7)10-6(4)2(8)9-5/h4-5H2,(H2,3,7)
InChIKeyIRCSGOJPHZGXFI-UHFFFAOYSA-N
MW150.09 g/mol
LogP-1.82
Rot. Bonds

About amino N-amino-N-carbamoyloxycarbamate

amino N-amino-N-carbamoyloxycarbamate (PubChem CID 174934503) has the molecular formula C2H6N4O4 and a molecular weight of 150.09 g/mol. Its IUPAC name is amino N-amino-N-carbamoyloxycarbamate.

Molecular Properties

Compound Nameamino N-amino-N-carbamoyloxycarbamate
PubChem CID174934503
Molecular FormulaC2H6N4O4
Molecular Weight150.09 g/mol
Exact Mass150.04
IUPAC Nameamino N-amino-N-carbamoyloxycarbamate
SMILESNOC(=O)N(N)OC(N)=O
InChIInChI=1S/C2H6N4O4/c3-1(7)10-6(4)2(8)9-5/h4-5H2,(H2,3,7)
InChIKeyIRCSGOJPHZGXFI-UHFFFAOYSA-N
XLogP-1.82
TPSA133.90 Ų
H-Bond Donors3
H-Bond Acceptors6
Rotatable Bonds
Heavy Atoms10
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500150.09
LogP ≤ 5-1.82
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 106

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze amino N-amino-N-carbamoyloxycarbamate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of amino N-amino-N-carbamoyloxycarbamate?
The IUPAC name of amino N-amino-N-carbamoyloxycarbamate (CID 174934503) is amino N-amino-N-carbamoyloxycarbamate.
What is the SMILES notation for amino N-amino-N-carbamoyloxycarbamate?
The canonical SMILES for amino N-amino-N-carbamoyloxycarbamate is NOC(=O)N(N)OC(N)=O.
What is the InChIKey of amino N-amino-N-carbamoyloxycarbamate?
The InChIKey is IRCSGOJPHZGXFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H6N4O4/c3-1(7)10-6(4)2(8)9-5/h4-5H2,(H2,3,7).
What are the key properties of amino N-amino-N-carbamoyloxycarbamate?
amino N-amino-N-carbamoyloxycarbamate has a molecular weight of 150.09 g/mol, XLogP of -1.82, 0 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for amino N-amino-N-carbamoyloxycarbamate is sourced from PubChem (CID 174934503), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).