C11H16Cl2N2O2 — CID 174935425
2-[2-(2-chloroethyl)hydrazinyl]-3-phenylpropanoic acid;hydrochloride (PubChem CID 174935425) has the molecular formula C11H16Cl2N2O2 and a molecular weight of 279.17 g/mol. Its IUPAC name is 2-[2-(2-chloroethyl)hydrazinyl]-3-phenylpropanoic acid;hydrochloride.
| Compound Name | 2-[2-(2-chloroethyl)hydrazinyl]-3-phenylpropanoic acid;hydrochloride |
|---|---|
| PubChem CID | 174935425 |
| Molecular Formula | C11H16Cl2N2O2 |
| Molecular Weight | 279.17 g/mol |
| Exact Mass | 278.06 |
| IUPAC Name | 2-[2-(2-chloroethyl)hydrazinyl]-3-phenylpropanoic acid;hydrochloride |
| SMILES | Cl.O=C(O)C(Cc1ccccc1)NNCCCl |
| InChI | InChI=1S/C11H15ClN2O2.ClH/c12-6-7-13-14-10(11(15)16)8-9-4-2-1-3-5-9;/h1-5,10,13-14H,6-8H2,(H,15,16);1H |
| InChIKey | RBXBDMJQLSNYDK-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.17 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|