C20H34N2O4 — CID 174942726
2-amino-4-methylpentanoic acid;2-(pentylamino)-3-phenylpropanoic acid (PubChem CID 174942726) has the molecular formula C20H34N2O4 and a molecular weight of 366.50 g/mol. Its IUPAC name is 2-amino-4-methylpentanoic acid;2-(pentylamino)-3-phenylpropanoic acid.
| Compound Name | 2-amino-4-methylpentanoic acid;2-(pentylamino)-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 174942726 |
| Molecular Formula | C20H34N2O4 |
| Molecular Weight | 366.50 g/mol |
| Exact Mass | 366.25 |
| IUPAC Name | 2-amino-4-methylpentanoic acid;2-(pentylamino)-3-phenylpropanoic acid |
| SMILES | CC(C)CC(N)C(=O)O.CCCCCNC(Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C14H21NO2.C6H13NO2/c1-2-3-7-10-15-13(14(16)17)11-12-8-5-4-6-9-12;1-4(2)3-5(7)6(8)9/h4-6,8-9,13,15H,2-3,7,10-11H2,1H3,(H,16,17);4-5H,3,7H2,1-2H3,(H,8,9) |
| InChIKey | GDRSEHKROCFULV-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.50 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|