C22H20FeN4OS — CID 174947613
21,22-dihydroporphyrin;iron;methylsulfinylmethane (PubChem CID 174947613) has the molecular formula C22H20FeN4OS and a molecular weight of 444.34 g/mol. Its IUPAC name is 21,22-dihydroporphyrin;iron;methylsulfinylmethane.
| Compound Name | 21,22-dihydroporphyrin;iron;methylsulfinylmethane |
|---|---|
| PubChem CID | 174947613 |
| Molecular Formula | C22H20FeN4OS |
| Molecular Weight | 444.34 g/mol |
| Exact Mass | 444.07 |
| IUPAC Name | 21,22-dihydroporphyrin;iron;methylsulfinylmethane |
| SMILES | C1=Cc2cc3ccc(cc4ccc(cc5nc(cc1n2)C=C5)[nH]4)[nH]3.CS(C)=O.[Fe] |
| InChI | InChI=1S/C20H14N4.C2H6OS.Fe/c1-2-14-10-16-5-6-18(23-16)12-20-8-7-19(24-20)11-17-4-3-15(22-17)9-13(1)21-14;1-4(2)3;/h1-12,21-22H;1-2H3;/b13-9-,14-10-,15-9-,16-10-,17-11-,18-12-,19-11-,20-12-;; |
| InChIKey | JDSLMTPIDWKELP-IAULSPAKSA-N |
| XLogP | 4.65 |
| TPSA | 74.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.34 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|