C5H8N2O6 — CID 174948995
4-(carbamoylamino)oxy-2-hydroxy-4-oxobutanoic acid (PubChem CID 174948995) has the molecular formula C5H8N2O6 and a molecular weight of 192.13 g/mol. Its IUPAC name is 4-(carbamoylamino)oxy-2-hydroxy-4-oxobutanoic acid.
| Compound Name | 4-(carbamoylamino)oxy-2-hydroxy-4-oxobutanoic acid |
|---|---|
| PubChem CID | 174948995 |
| Molecular Formula | C5H8N2O6 |
| Molecular Weight | 192.13 g/mol |
| Exact Mass | 192.04 |
| IUPAC Name | 4-(carbamoylamino)oxy-2-hydroxy-4-oxobutanoic acid |
| SMILES | NC(=O)NOC(=O)CC(O)C(=O)O |
| InChI | InChI=1S/C5H8N2O6/c6-5(12)7-13-3(9)1-2(8)4(10)11/h2,8H,1H2,(H,10,11)(H3,6,7,12) |
| InChIKey | YQBGEDJXXCRIGG-UHFFFAOYSA-N |
| XLogP | -2.05 |
| TPSA | 138.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.13 |
| LogP ≤ 5 | -2.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|