C14H15Cl4F3N2O5S — CID 174957416
3-[4-(2,2,2-trichloroacetyl)piperazin-1-yl]-4-(2,2,2-trifluoroethoxy)benzenesulfonic acid;hydrochloride (PubChem CID 174957416) has the molecular formula C14H15Cl4F3N2O5S and a molecular weight of 522.16 g/mol. Its IUPAC name is 3-[4-(2,2,2-trichloroacetyl)piperazin-1-yl]-4-(2,2,2-trifluoroethoxy)benzenesulfonic acid;hydrochloride.
| Compound Name | 3-[4-(2,2,2-trichloroacetyl)piperazin-1-yl]-4-(2,2,2-trifluoroethoxy)benzenesulfonic acid;hydrochloride |
|---|---|
| PubChem CID | 174957416 |
| Molecular Formula | C14H15Cl4F3N2O5S |
| Molecular Weight | 522.16 g/mol |
| Exact Mass | 519.94 |
| IUPAC Name | 3-[4-(2,2,2-trichloroacetyl)piperazin-1-yl]-4-(2,2,2-trifluoroethoxy)benzenesulfonic acid;hydrochloride |
| SMILES | Cl.O=C(N1CCN(c2cc(S(=O)(=O)O)ccc2OCC(F)(F)F)CC1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C14H14Cl3F3N2O5S.ClH/c15-14(16,17)12(23)22-5-3-21(4-6-22)10-7-9(28(24,25)26)1-2-11(10)27-8-13(18,19)20;/h1-2,7H,3-6,8H2,(H,24,25,26);1H |
| InChIKey | HPWRWENZHMIQBH-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.16 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|