About (4-aminoanilino) 4-oxobut-2-enoate
(4-aminoanilino) 4-oxobut-2-enoate (PubChem CID 174959305) has the molecular formula C10H10N2O3
and a molecular weight of 206.20 g/mol. Its IUPAC name is (4-aminoanilino) 4-oxobut-2-enoate.
Molecular Properties
| Compound Name | (4-aminoanilino) 4-oxobut-2-enoate |
| PubChem CID | 174959305 |
| Molecular Formula | C10H10N2O3 |
| Molecular Weight | 206.20 g/mol |
| Exact Mass | 206.07 |
| IUPAC Name | (4-aminoanilino) 4-oxobut-2-enoate |
| SMILES | Nc1ccc(NOC(=O)C=CC=O)cc1 |
| InChI | InChI=1S/C10H10N2O3/c11-8-3-5-9(6-4-8)12-15-10(14)2-1-7-13/h1-7,12H,11H2 |
| InChIKey | IBDREEWUTVVSIB-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.20 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (4-aminoanilino) 4-oxobut-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-aminoanilino) 4-oxobut-2-enoate?
The IUPAC name of (4-aminoanilino) 4-oxobut-2-enoate (CID 174959305) is (4-aminoanilino) 4-oxobut-2-enoate.
What is the SMILES notation for (4-aminoanilino) 4-oxobut-2-enoate?
The canonical SMILES for (4-aminoanilino) 4-oxobut-2-enoate is Nc1ccc(NOC(=O)C=CC=O)cc1.
What is the InChIKey of (4-aminoanilino) 4-oxobut-2-enoate?
The InChIKey is IBDREEWUTVVSIB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N2O3/c11-8-3-5-9(6-4-8)12-15-10(14)2-1-7-13/h1-7,12H,11H2.
What are the key properties of (4-aminoanilino) 4-oxobut-2-enoate?
(4-aminoanilino) 4-oxobut-2-enoate has a molecular weight of 206.20 g/mol, XLogP of 0.89, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4-aminoanilino) 4-oxobut-2-enoate is sourced from PubChem (CID 174959305), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).