C14H22FeSi2-6 — CID 174959903
cyclopentane;(2-dimethylsilylcyclopenta-2,4-dien-1-yl)-dimethylsilane;iron (PubChem CID 174959903) has the molecular formula C14H22FeSi2-6 and a molecular weight of 302.35 g/mol. Its IUPAC name is cyclopentane;(2-dimethylsilylcyclopenta-2,4-dien-1-yl)-dimethylsilane;iron.
| Compound Name | cyclopentane;(2-dimethylsilylcyclopenta-2,4-dien-1-yl)-dimethylsilane;iron |
|---|---|
| PubChem CID | 174959903 |
| Molecular Formula | C14H22FeSi2-6 |
| Molecular Weight | 302.35 g/mol |
| Exact Mass | 302.06 |
| IUPAC Name | cyclopentane;(2-dimethylsilylcyclopenta-2,4-dien-1-yl)-dimethylsilane;iron |
| SMILES | C[SiH](C)c1ccc[c-]1[SiH](C)C.[Fe].[cH-]1[cH-][cH-][cH-][cH-]1 |
| InChI | InChI=1S/C9H17Si2.C5H5.Fe/c1-10(2)8-6-5-7-9(8)11(3)4;1-2-4-5-3-1;/h5-7,10-11H,1-4H3;1-5H;/q-1;-5; |
| InChIKey | PCYWJZHLCKFHAI-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.35 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|