C18H21OP — CID 174960261
(3-ethyl-2,4,6-trimethylphenyl)-phenylphosphanylmethanone (PubChem CID 174960261) has the molecular formula C18H21OP and a molecular weight of 284.34 g/mol. Its IUPAC name is (3-ethyl-2,4,6-trimethylphenyl)-phenylphosphanylmethanone.
| Compound Name | (3-ethyl-2,4,6-trimethylphenyl)-phenylphosphanylmethanone |
|---|---|
| PubChem CID | 174960261 |
| Molecular Formula | C18H21OP |
| Molecular Weight | 284.34 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | (3-ethyl-2,4,6-trimethylphenyl)-phenylphosphanylmethanone |
| SMILES | CCc1c(C)cc(C)c(C(=O)Pc2ccccc2)c1C |
| InChI | InChI=1S/C18H21OP/c1-5-16-12(2)11-13(3)17(14(16)4)18(19)20-15-9-7-6-8-10-15/h6-11,20H,5H2,1-4H3 |
| InChIKey | RFXKIFJEKRUCDD-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.34 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|