C7H5NO7S2Zn — CID 174966585
zinc;1,1-dioxo-1,2-benzothiazol-3-one;sulfate (PubChem CID 174966585) has the molecular formula C7H5NO7S2Zn and a molecular weight of 344.64 g/mol. Its IUPAC name is zinc;1,1-dioxo-1,2-benzothiazol-3-one;sulfate.
| Compound Name | zinc;1,1-dioxo-1,2-benzothiazol-3-one;sulfate |
|---|---|
| PubChem CID | 174966585 |
| Molecular Formula | C7H5NO7S2Zn |
| Molecular Weight | 344.64 g/mol |
| Exact Mass | 342.88 |
| IUPAC Name | zinc;1,1-dioxo-1,2-benzothiazol-3-one;sulfate |
| SMILES | O=C1NS(=O)(=O)c2ccccc21.O=S(=O)([O-])[O-].[Zn+2] |
| InChI | InChI=1S/C7H5NO3S.H2O4S.Zn/c9-7-5-3-1-2-4-6(5)12(10,11)8-7;1-5(2,3)4;/h1-4H,(H,8,9);(H2,1,2,3,4);/q;;+2/p-2 |
| InChIKey | SBMUVEDCSYDWMY-UHFFFAOYSA-L |
| XLogP | -1.22 |
| TPSA | 143.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.64 |
| LogP ≤ 5 | -1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|