C11H22N4O5 — CID 174997154
tert-butyl N-[[2-[(2-aminoacetyl)amino]acetyl]amino]-N-ethoxycarbamate (PubChem CID 174997154) has the molecular formula C11H22N4O5 and a molecular weight of 290.32 g/mol. Its IUPAC name is tert-butyl N-[[2-[(2-aminoacetyl)amino]acetyl]amino]-N-ethoxycarbamate.
| Compound Name | tert-butyl N-[[2-[(2-aminoacetyl)amino]acetyl]amino]-N-ethoxycarbamate |
|---|---|
| PubChem CID | 174997154 |
| Molecular Formula | C11H22N4O5 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.16 |
| IUPAC Name | tert-butyl N-[[2-[(2-aminoacetyl)amino]acetyl]amino]-N-ethoxycarbamate |
| SMILES | CCON(NC(=O)CNC(=O)CN)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C11H22N4O5/c1-5-19-15(10(18)20-11(2,3)4)14-9(17)7-13-8(16)6-12/h5-7,12H2,1-4H3,(H,13,16)(H,14,17) |
| InChIKey | RXIVODMJELTHQC-UHFFFAOYSA-N |
| XLogP | -0.72 |
| TPSA | 122.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|