C18H33NO4Si — CID 175007746
N-[4-(1,1-dimethoxypropyl-methoxy-methylsilyl)oxypentyl]aniline (PubChem CID 175007746) has the molecular formula C18H33NO4Si and a molecular weight of 355.55 g/mol. Its IUPAC name is N-[4-(1,1-dimethoxypropyl-methoxy-methylsilyl)oxypentyl]aniline.
| Compound Name | N-[4-(1,1-dimethoxypropyl-methoxy-methylsilyl)oxypentyl]aniline |
|---|---|
| PubChem CID | 175007746 |
| Molecular Formula | C18H33NO4Si |
| Molecular Weight | 355.55 g/mol |
| Exact Mass | 355.22 |
| IUPAC Name | N-[4-(1,1-dimethoxypropyl-methoxy-methylsilyl)oxypentyl]aniline |
| SMILES | CCC(OC)(OC)[Si](C)(OC)OC(C)CCCNc1ccccc1 |
| InChI | InChI=1S/C18H33NO4Si/c1-7-18(20-3,21-4)24(6,22-5)23-16(2)12-11-15-19-17-13-9-8-10-14-17/h8-10,13-14,16,19H,7,11-12,15H2,1-6H3 |
| InChIKey | NLZFHXYFQQUPNT-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 48.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.55 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|