C17H31NO2Si — CID 175181392
N-[4-[ethoxy(diethyl)silyl]oxypentyl]aniline (PubChem CID 175181392) has the molecular formula C17H31NO2Si and a molecular weight of 309.53 g/mol. Its IUPAC name is N-[4-[ethoxy(diethyl)silyl]oxypentyl]aniline.
| Compound Name | N-[4-[ethoxy(diethyl)silyl]oxypentyl]aniline |
|---|---|
| PubChem CID | 175181392 |
| Molecular Formula | C17H31NO2Si |
| Molecular Weight | 309.53 g/mol |
| Exact Mass | 309.21 |
| IUPAC Name | N-[4-[ethoxy(diethyl)silyl]oxypentyl]aniline |
| SMILES | CCO[Si](CC)(CC)OC(C)CCCNc1ccccc1 |
| InChI | InChI=1S/C17H31NO2Si/c1-5-19-21(6-2,7-3)20-16(4)12-11-15-18-17-13-9-8-10-14-17/h8-10,13-14,16,18H,5-7,11-12,15H2,1-4H3 |
| InChIKey | BYNURUBQIHJHBP-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.53 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|