C14H11N4O3P — CID 175007841
(N-(2,5-dicyanoanilino)anilino)phosphonic acid (PubChem CID 175007841) has the molecular formula C14H11N4O3P and a molecular weight of 314.24 g/mol. Its IUPAC name is (N-(2,5-dicyanoanilino)anilino)phosphonic acid.
| Compound Name | (N-(2,5-dicyanoanilino)anilino)phosphonic acid |
|---|---|
| PubChem CID | 175007841 |
| Molecular Formula | C14H11N4O3P |
| Molecular Weight | 314.24 g/mol |
| Exact Mass | 314.06 |
| IUPAC Name | (N-(2,5-dicyanoanilino)anilino)phosphonic acid |
| SMILES | N#Cc1ccc(C#N)c(NN(c2ccccc2)P(=O)(O)O)c1 |
| InChI | InChI=1S/C14H11N4O3P/c15-9-11-6-7-12(10-16)14(8-11)17-18(22(19,20)21)13-4-2-1-3-5-13/h1-8,17H,(H2,19,20,21) |
| InChIKey | LYLJEYNMYCCCBG-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 120.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.24 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|