C6H12N3O5P — CID 175022354
2-[carbamimidoyl(methyl)amino]-2-phosphonobut-3-enoic acid (PubChem CID 175022354) has the molecular formula C6H12N3O5P and a molecular weight of 237.15 g/mol. Its IUPAC name is 2-[carbamimidoyl(methyl)amino]-2-phosphonobut-3-enoic acid.
| Compound Name | 2-[carbamimidoyl(methyl)amino]-2-phosphonobut-3-enoic acid |
|---|---|
| PubChem CID | 175022354 |
| Molecular Formula | C6H12N3O5P |
| Molecular Weight | 237.15 g/mol |
| Exact Mass | 237.05 |
| IUPAC Name | 2-[carbamimidoyl(methyl)amino]-2-phosphonobut-3-enoic acid |
| SMILES | [H]/N=C(\N)N(C)C(C=C)(C(=O)O)P(=O)(O)O |
| InChI | InChI=1S/C6H12N3O5P/c1-3-6(4(10)11,15(12,13)14)9(2)5(7)8/h3H,1H2,2H3,(H3,7,8)(H,10,11)(H2,12,13,14) |
| InChIKey | GUBMFUISKADNAH-UHFFFAOYSA-N |
| XLogP | -1.04 |
| TPSA | 147.94 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.15 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|