C18H29NO6S — CID 175024781
azane;2,3,4,6-tetramethyl-5-[2-[2-(2-methylprop-2-enoyloxy)ethoxy]ethyl]benzenesulfonic acid (PubChem CID 175024781) has the molecular formula C18H29NO6S and a molecular weight of 387.50 g/mol. Its IUPAC name is azane;2,3,4,6-tetramethyl-5-[2-[2-(2-methylprop-2-enoyloxy)ethoxy]ethyl]benzenesulfonic acid.
| Compound Name | azane;2,3,4,6-tetramethyl-5-[2-[2-(2-methylprop-2-enoyloxy)ethoxy]ethyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 175024781 |
| Molecular Formula | C18H29NO6S |
| Molecular Weight | 387.50 g/mol |
| Exact Mass | 387.17 |
| IUPAC Name | azane;2,3,4,6-tetramethyl-5-[2-[2-(2-methylprop-2-enoyloxy)ethoxy]ethyl]benzenesulfonic acid |
| SMILES | C=C(C)C(=O)OCCOCCc1c(C)c(C)c(C)c(S(=O)(=O)O)c1C.N |
| InChI | InChI=1S/C18H26O6S.H3N/c1-11(2)18(19)24-10-9-23-8-7-16-13(4)12(3)14(5)17(15(16)6)25(20,21)22;/h1,7-10H2,2-6H3,(H,20,21,22);1H3 |
| InChIKey | JNRJNORNAHMISB-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 124.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.50 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|