C18H26O6S — CID 175024782
2,3,4,6-tetramethyl-5-[2-[2-(2-methylprop-2-enoyloxy)ethoxy]ethyl]benzenesulfonic acid (PubChem CID 175024782) has the molecular formula C18H26O6S and a molecular weight of 370.47 g/mol. Its IUPAC name is 2,3,4,6-tetramethyl-5-[2-[2-(2-methylprop-2-enoyloxy)ethoxy]ethyl]benzenesulfonic acid.
| Compound Name | 2,3,4,6-tetramethyl-5-[2-[2-(2-methylprop-2-enoyloxy)ethoxy]ethyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 175024782 |
| Molecular Formula | C18H26O6S |
| Molecular Weight | 370.47 g/mol |
| Exact Mass | 370.15 |
| IUPAC Name | 2,3,4,6-tetramethyl-5-[2-[2-(2-methylprop-2-enoyloxy)ethoxy]ethyl]benzenesulfonic acid |
| SMILES | C=C(C)C(=O)OCCOCCc1c(C)c(C)c(C)c(S(=O)(=O)O)c1C |
| InChI | InChI=1S/C18H26O6S/c1-11(2)18(19)24-10-9-23-8-7-16-13(4)12(3)14(5)17(15(16)6)25(20,21)22/h1,7-10H2,2-6H3,(H,20,21,22) |
| InChIKey | OBVVVKLLDSCJQX-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.47 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|