C24H32Cl2N2O2Si — CID 175028374
(3R,4R)-3-[tert-butyl(dimethyl)silyl]oxy-4-(3,6-dichlorocarbazol-9-yl)azepan-2-ol (PubChem CID 175028374) has the molecular formula C24H32Cl2N2O2Si and a molecular weight of 479.52 g/mol. Its IUPAC name is (3R,4R)-3-[tert-butyl(dimethyl)silyl]oxy-4-(3,6-dichlorocarbazol-9-yl)azepan-2-ol.
| Compound Name | (3R,4R)-3-[tert-butyl(dimethyl)silyl]oxy-4-(3,6-dichlorocarbazol-9-yl)azepan-2-ol |
|---|---|
| PubChem CID | 175028374 |
| Molecular Formula | C24H32Cl2N2O2Si |
| Molecular Weight | 479.52 g/mol |
| Exact Mass | 478.16 |
| IUPAC Name | (3R,4R)-3-[tert-butyl(dimethyl)silyl]oxy-4-(3,6-dichlorocarbazol-9-yl)azepan-2-ol |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1C(O)NCCC[C@H]1n1c2ccc(Cl)cc2c2cc(Cl)ccc21 |
| InChI | InChI=1S/C24H32Cl2N2O2Si/c1-24(2,3)31(4,5)30-22-21(7-6-12-27-23(22)29)28-19-10-8-15(25)13-17(19)18-14-16(26)9-11-20(18)28/h8-11,13-14,21-23,27,29H,6-7,12H2,1-5H3/t21-,22-,23?/m1/s1 |
| InChIKey | WNVXCEHJPPZAOW-WELAQSEPSA-N |
| XLogP | 6.73 |
| TPSA | 46.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.52 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|