C30H24N2P+ — CID 175029636
triphenyl(9H-pyrido[3,4-b]indol-3-ylmethyl)phosphanium (PubChem CID 175029636) has the molecular formula C30H24N2P+ and a molecular weight of 443.51 g/mol. Its IUPAC name is triphenyl(9H-pyrido[3,4-b]indol-3-ylmethyl)phosphanium.
| Compound Name | triphenyl(9H-pyrido[3,4-b]indol-3-ylmethyl)phosphanium |
|---|---|
| PubChem CID | 175029636 |
| Molecular Formula | C30H24N2P+ |
| Molecular Weight | 443.51 g/mol |
| Exact Mass | 443.17 |
| IUPAC Name | triphenyl(9H-pyrido[3,4-b]indol-3-ylmethyl)phosphanium |
| SMILES | c1ccc([P+](Cc2cc3c(cn2)[nH]c2ccccc23)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C30H24N2P/c1-4-12-24(13-5-1)33(25-14-6-2-7-15-25,26-16-8-3-9-17-26)22-23-20-28-27-18-10-11-19-29(27)32-30(28)21-31-23/h1-21,32H,22H2/q+1 |
| InChIKey | YAPLIZDTYAKWIJ-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.51 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|