C14H15ClN2O — CID 77461260
3-propan-2-yloxy-9H-pyrido[3,4-b]indole;hydrochloride (PubChem CID 77461260) has the molecular formula C14H15ClN2O and a molecular weight of 262.74 g/mol. Its IUPAC name is 3-propan-2-yloxy-9H-pyrido[3,4-b]indole;hydrochloride.
| Compound Name | 3-propan-2-yloxy-9H-pyrido[3,4-b]indole;hydrochloride |
|---|---|
| PubChem CID | 77461260 |
| Molecular Formula | C14H15ClN2O |
| Molecular Weight | 262.74 g/mol |
| Exact Mass | 262.09 |
| IUPAC Name | 3-propan-2-yloxy-9H-pyrido[3,4-b]indole;hydrochloride |
| SMILES | CC(C)Oc1cc2c(cn1)[nH]c1ccccc12.Cl |
| InChI | InChI=1S/C14H14N2O.ClH/c1-9(2)17-14-7-11-10-5-3-4-6-12(10)16-13(11)8-15-14;/h3-9,16H,1-2H3;1H |
| InChIKey | WSZGRWISZLOJAI-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.74 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |