C13H12N2O — CID 129365033
(1S)-1-(9H-pyrido[3,4-b]indol-3-yl)ethanol (PubChem CID 129365033) has the molecular formula C13H12N2O and a molecular weight of 212.25 g/mol. Its IUPAC name is (1S)-1-(9H-pyrido[3,4-b]indol-3-yl)ethanol.
| Compound Name | (1S)-1-(9H-pyrido[3,4-b]indol-3-yl)ethanol |
|---|---|
| PubChem CID | 129365033 |
| Molecular Formula | C13H12N2O |
| Molecular Weight | 212.25 g/mol |
| Exact Mass | 212.09 |
| IUPAC Name | (1S)-1-(9H-pyrido[3,4-b]indol-3-yl)ethanol |
| SMILES | C[C@H](O)c1cc2c(cn1)[nH]c1ccccc12 |
| InChI | InChI=1S/C13H12N2O/c1-8(16)12-6-10-9-4-2-3-5-11(9)15-13(10)7-14-12/h2-8,15-16H,1H3/t8-/m0/s1 |
| InChIKey | DSUBZVLNKPDONN-QMMMGPOBSA-N |
| XLogP | 2.77 |
| TPSA | 48.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.25 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |