C9H6F6O2S — CID 175031163
1,2,2,3,3,3-hexafluoropropylsulfonylbenzene (PubChem CID 175031163) has the molecular formula C9H6F6O2S and a molecular weight of 292.20 g/mol. Its IUPAC name is 1,2,2,3,3,3-hexafluoropropylsulfonylbenzene.
| Compound Name | 1,2,2,3,3,3-hexafluoropropylsulfonylbenzene |
|---|---|
| PubChem CID | 175031163 |
| Molecular Formula | C9H6F6O2S |
| Molecular Weight | 292.20 g/mol |
| Exact Mass | 292.00 |
| IUPAC Name | 1,2,2,3,3,3-hexafluoropropylsulfonylbenzene |
| SMILES | O=S(=O)(c1ccccc1)C(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H6F6O2S/c10-7(8(11,12)9(13,14)15)18(16,17)6-4-2-1-3-5-6/h1-5,7H |
| InChIKey | KSJIISOZBBENTP-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.20 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|