C32H23AgO2 — CID 175035267
silver 2-(2,3-diphenylphenyl)-2,2-diphenylacetate (PubChem CID 175035267) has the molecular formula C32H23AgO2 and a molecular weight of 547.40 g/mol. Its IUPAC name is silver 2-(2,3-diphenylphenyl)-2,2-diphenylacetate.
| Compound Name | silver 2-(2,3-diphenylphenyl)-2,2-diphenylacetate |
|---|---|
| PubChem CID | 175035267 |
| Molecular Formula | C32H23AgO2 |
| Molecular Weight | 547.40 g/mol |
| Exact Mass | 546.07 |
| IUPAC Name | silver 2-(2,3-diphenylphenyl)-2,2-diphenylacetate |
| SMILES | O=C([O-])C(c1ccccc1)(c1ccccc1)c1cccc(-c2ccccc2)c1-c1ccccc1.[Ag+] |
| InChI | InChI=1S/C32H24O2.Ag/c33-31(34)32(26-18-9-3-10-19-26,27-20-11-4-12-21-27)29-23-13-22-28(24-14-5-1-6-15-24)30(29)25-16-7-2-8-17-25;/h1-23H,(H,33,34);/q;+1/p-1 |
| InChIKey | CACRDUWAXWRHMW-UHFFFAOYSA-M |
| XLogP | 6.10 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.40 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|