C31H26ClP — CID 160830813
[(2,3-diphenylphenyl)-diphenylmethyl]phosphanium chloride (PubChem CID 160830813) has the molecular formula C31H26ClP and a molecular weight of 464.98 g/mol. Its IUPAC name is [(2,3-diphenylphenyl)-diphenylmethyl]phosphanium chloride.
| Compound Name | [(2,3-diphenylphenyl)-diphenylmethyl]phosphanium chloride |
|---|---|
| PubChem CID | 160830813 |
| Molecular Formula | C31H26ClP |
| Molecular Weight | 464.98 g/mol |
| Exact Mass | 464.15 |
| IUPAC Name | [(2,3-diphenylphenyl)-diphenylmethyl]phosphanium chloride |
| SMILES | [Cl-].[PH3+]C(c1ccccc1)(c1ccccc1)c1cccc(-c2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C31H25P.ClH/c32-31(26-18-9-3-10-19-26,27-20-11-4-12-21-27)29-23-13-22-28(24-14-5-1-6-15-24)30(29)25-16-7-2-8-17-25;/h1-23H,32H2;1H |
| InChIKey | MHCPZBHATDLBML-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.98 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|