C31H47NO5 — CID 175036057
[2-(2-cyclopentyl-2-hydroxy-2-phenylacetyl)oxy-7-azaspiro[3.5]nonan-3-yl] 2-ethyloctanoate (PubChem CID 175036057) has the molecular formula C31H47NO5 and a molecular weight of 513.72 g/mol. Its IUPAC name is [2-(2-cyclopentyl-2-hydroxy-2-phenylacetyl)oxy-7-azaspiro[3.5]nonan-3-yl] 2-ethyloctanoate.
| Compound Name | [2-(2-cyclopentyl-2-hydroxy-2-phenylacetyl)oxy-7-azaspiro[3.5]nonan-3-yl] 2-ethyloctanoate |
|---|---|
| PubChem CID | 175036057 |
| Molecular Formula | C31H47NO5 |
| Molecular Weight | 513.72 g/mol |
| Exact Mass | 513.35 |
| IUPAC Name | [2-(2-cyclopentyl-2-hydroxy-2-phenylacetyl)oxy-7-azaspiro[3.5]nonan-3-yl] 2-ethyloctanoate |
| SMILES | CCCCCCC(CC)C(=O)OC1C(OC(=O)C(O)(c2ccccc2)C2CCCC2)CC12CCNCC2 |
| InChI | InChI=1S/C31H47NO5/c1-3-5-6-8-13-23(4-2)28(33)37-27-26(22-30(27)18-20-32-21-19-30)36-29(34)31(35,25-16-11-12-17-25)24-14-9-7-10-15-24/h7,9-10,14-15,23,25-27,32,35H,3-6,8,11-13,16-22H2,1-2H3 |
| InChIKey | GIWCMAISMWSCOM-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.72 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|