About (6-chloro-4-hydroxy-2,3-diphenylphenyl) hypochlorite
(6-chloro-4-hydroxy-2,3-diphenylphenyl) hypochlorite (PubChem CID 175042098) has the molecular formula C18H12Cl2O2
and a molecular weight of 331.20 g/mol. Its IUPAC name is (6-chloro-4-hydroxy-2,3-diphenylphenyl) hypochlorite.
Molecular Properties
| Compound Name | (6-chloro-4-hydroxy-2,3-diphenylphenyl) hypochlorite |
| PubChem CID | 175042098 |
| Molecular Formula | C18H12Cl2O2 |
| Molecular Weight | 331.20 g/mol |
| Exact Mass | 330.02 |
| IUPAC Name | (6-chloro-4-hydroxy-2,3-diphenylphenyl) hypochlorite |
| SMILES | Oc1cc(Cl)c(OCl)c(-c2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C18H12Cl2O2/c19-14-11-15(21)16(12-7-3-1-4-8-12)17(18(14)22-20)13-9-5-2-6-10-13/h1-11,21H |
| InChIKey | ILMBEJMERBAZKK-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 331.20 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (6-chloro-4-hydroxy-2,3-diphenylphenyl) hypochlorite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-chloro-4-hydroxy-2,3-diphenylphenyl) hypochlorite?
The IUPAC name of (6-chloro-4-hydroxy-2,3-diphenylphenyl) hypochlorite (CID 175042098) is (6-chloro-4-hydroxy-2,3-diphenylphenyl) hypochlorite.
What is the SMILES notation for (6-chloro-4-hydroxy-2,3-diphenylphenyl) hypochlorite?
The canonical SMILES for (6-chloro-4-hydroxy-2,3-diphenylphenyl) hypochlorite is Oc1cc(Cl)c(OCl)c(-c2ccccc2)c1-c1ccccc1.
What is the InChIKey of (6-chloro-4-hydroxy-2,3-diphenylphenyl) hypochlorite?
The InChIKey is ILMBEJMERBAZKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H12Cl2O2/c19-14-11-15(21)16(12-7-3-1-4-8-12)17(18(14)22-20)13-9-5-2-6-10-13/h1-11,21H.
What are the key properties of (6-chloro-4-hydroxy-2,3-diphenylphenyl) hypochlorite?
(6-chloro-4-hydroxy-2,3-diphenylphenyl) hypochlorite has a molecular weight of 331.20 g/mol, XLogP of 5.91, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (6-chloro-4-hydroxy-2,3-diphenylphenyl) hypochlorite is sourced from PubChem (CID 175042098), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).