C22H14Cl2O — CID 170563518
6,7-dichloro-3,4-diphenylnaphthalen-2-ol (PubChem CID 170563518) has the molecular formula C22H14Cl2O and a molecular weight of 365.26 g/mol. Its IUPAC name is 6,7-dichloro-3,4-diphenylnaphthalen-2-ol.
| Compound Name | 6,7-dichloro-3,4-diphenylnaphthalen-2-ol |
|---|---|
| PubChem CID | 170563518 |
| Molecular Formula | C22H14Cl2O |
| Molecular Weight | 365.26 g/mol |
| Exact Mass | 364.04 |
| IUPAC Name | 6,7-dichloro-3,4-diphenylnaphthalen-2-ol |
| SMILES | Oc1cc2cc(Cl)c(Cl)cc2c(-c2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C22H14Cl2O/c23-18-11-16-12-20(25)22(15-9-5-2-6-10-15)21(17(16)13-19(18)24)14-7-3-1-4-8-14/h1-13,25H |
| InChIKey | KXJQHKXBODDYJQ-UHFFFAOYSA-N |
| XLogP | 7.19 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.26 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |