C34H23ClO — CID 177437957
3-chloro-5,6,7,8-tetraphenylnaphthalen-1-ol (PubChem CID 177437957) has the molecular formula C34H23ClO and a molecular weight of 483.01 g/mol. Its IUPAC name is 3-chloro-5,6,7,8-tetraphenylnaphthalen-1-ol.
| Compound Name | 3-chloro-5,6,7,8-tetraphenylnaphthalen-1-ol |
|---|---|
| PubChem CID | 177437957 |
| Molecular Formula | C34H23ClO |
| Molecular Weight | 483.01 g/mol |
| Exact Mass | 482.14 |
| IUPAC Name | 3-chloro-5,6,7,8-tetraphenylnaphthalen-1-ol |
| SMILES | Oc1cc(Cl)cc2c(-c3ccccc3)c(-c3ccccc3)c(-c3ccccc3)c(-c3ccccc3)c12 |
| InChI | InChI=1S/C34H23ClO/c35-27-21-28-30(23-13-5-1-6-14-23)31(24-15-7-2-8-16-24)32(25-17-9-3-10-18-25)33(34(28)29(36)22-27)26-19-11-4-12-20-26/h1-22,36H |
| InChIKey | LPBVNJUUJMPOCH-UHFFFAOYSA-N |
| XLogP | 9.87 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.01 |
| LogP ≤ 5 | 9.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |