C6H14O6S — CID 175042463
1,4-dihydroxy-2-(hydroxymethyl)-3-methylbutane-2-sulfonic acid (PubChem CID 175042463) has the molecular formula C6H14O6S and a molecular weight of 214.24 g/mol. Its IUPAC name is 1,4-dihydroxy-2-(hydroxymethyl)-3-methylbutane-2-sulfonic acid.
| Compound Name | 1,4-dihydroxy-2-(hydroxymethyl)-3-methylbutane-2-sulfonic acid |
|---|---|
| PubChem CID | 175042463 |
| Molecular Formula | C6H14O6S |
| Molecular Weight | 214.24 g/mol |
| Exact Mass | 214.05 |
| IUPAC Name | 1,4-dihydroxy-2-(hydroxymethyl)-3-methylbutane-2-sulfonic acid |
| SMILES | CC(CO)C(CO)(CO)S(=O)(=O)O |
| InChI | InChI=1S/C6H14O6S/c1-5(2-7)6(3-8,4-9)13(10,11)12/h5,7-9H,2-4H2,1H3,(H,10,11,12) |
| InChIKey | UJQLQPWHPLKICD-UHFFFAOYSA-N |
| XLogP | -1.77 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.24 |
| LogP ≤ 5 | -1.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|