C27H28ClF3N4O3 — CID 175049391
4-(6-acetamido-3-pyridinyl)-N-[(1S,2S)-1-[4-chloro-3-(trifluoromethyl)anilino]-1-hydroxy-3,3-dimethylbutan-2-yl]benzamide (PubChem CID 175049391) has the molecular formula C27H28ClF3N4O3 and a molecular weight of 548.99 g/mol. Its IUPAC name is 4-(6-acetamido-3-pyridinyl)-N-[(1S,2S)-1-[4-chloro-3-(trifluoromethyl)anilino]-1-hydroxy-3,3-dimethylbutan-2-yl]benzamide.
| Compound Name | 4-(6-acetamido-3-pyridinyl)-N-[(1S,2S)-1-[4-chloro-3-(trifluoromethyl)anilino]-1-hydroxy-3,3-dimethylbutan-2-yl]benzamide |
|---|---|
| PubChem CID | 175049391 |
| Molecular Formula | C27H28ClF3N4O3 |
| Molecular Weight | 548.99 g/mol |
| Exact Mass | 548.18 |
| IUPAC Name | 4-(6-acetamido-3-pyridinyl)-N-[(1S,2S)-1-[4-chloro-3-(trifluoromethyl)anilino]-1-hydroxy-3,3-dimethylbutan-2-yl]benzamide |
| SMILES | CC(=O)Nc1ccc(-c2ccc(C(=O)N[C@H]([C@H](O)Nc3ccc(Cl)c(C(F)(F)F)c3)C(C)(C)C)cc2)cn1 |
| InChI | InChI=1S/C27H28ClF3N4O3/c1-15(36)33-22-12-9-18(14-32-22)16-5-7-17(8-6-16)24(37)35-23(26(2,3)4)25(38)34-19-10-11-21(28)20(13-19)27(29,30)31/h5-14,23,25,34,38H,1-4H3,(H,35,37)(H,32,33,36)/t23-,25+/m1/s1 |
| InChIKey | GOFWBIKMRADTAJ-NOZRDPDXSA-N |
| XLogP | 5.95 |
| TPSA | 103.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.99 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|