C21H24BCl2N2O11 — CID 175054008
CID 175054008 (PubChem CID 175054008) has the molecular formula C21H24BCl2N2O11 and a molecular weight of 562.14 g/mol.
| Compound Name | CID 175054008 |
|---|---|
| PubChem CID | 175054008 |
| Molecular Formula | C21H24BCl2N2O11 |
| Molecular Weight | 562.14 g/mol |
| Exact Mass | 561.09 |
| IUPAC Name | — |
| SMILES | CC(C)C[C@@H](NC(=O)CNC(=O)c1cc(Cl)ccc1Cl)C(=O)OC(=O)CC(O)(CC(=O)O[B]O)C(=O)O |
| InChI | InChI=1S/C21H24BCl2N2O11/c1-10(2)5-14(26-15(27)9-25-18(30)12-6-11(23)3-4-13(12)24)19(31)36-16(28)7-21(34,20(32)33)8-17(29)37-22-35/h3-4,6,10,14,34-35H,5,7-9H2,1-2H3,(H,25,30)(H,26,27)(H,32,33)/t14-,21?/m1/s1 |
| InChIKey | ZZUOIBPHXJXIPO-CKAQCJTGSA-N |
| XLogP | -0.01 |
| TPSA | 205.63 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.14 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|