About [4-[2,6-difluorooxy-4-(4-pyridin-2-yltriazol-1-yl)phenyl]phenyl] hypofluorite
[4-[2,6-difluorooxy-4-(4-pyridin-2-yltriazol-1-yl)phenyl]phenyl] hypofluorite (PubChem CID 175061772) has the molecular formula C19H11F3N4O3
and a molecular weight of 400.32 g/mol. Its IUPAC name is [4-[2,6-difluorooxy-4-(4-pyridin-2-yltriazol-1-yl)phenyl]phenyl] hypofluorite.
Molecular Properties
| Compound Name | [4-[2,6-difluorooxy-4-(4-pyridin-2-yltriazol-1-yl)phenyl]phenyl] hypofluorite |
| PubChem CID | 175061772 |
| Molecular Formula | C19H11F3N4O3 |
| Molecular Weight | 400.32 g/mol |
| Exact Mass | 400.08 |
| IUPAC Name | [4-[2,6-difluorooxy-4-(4-pyridin-2-yltriazol-1-yl)phenyl]phenyl] hypofluorite |
| SMILES | FOc1ccc(-c2c(OF)cc(-n3cc(-c4ccccn4)nn3)cc2OF)cc1 |
| InChI | InChI=1S/C19H11F3N4O3/c20-27-14-6-4-12(5-7-14)19-17(28-21)9-13(10-18(19)29-22)26-11-16(24-25-26)15-3-1-2-8-23-15/h1-11H |
| InChIKey | BECKHVRZCJHPHQ-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 71.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 400.32 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze [4-[2,6-difluorooxy-4-(4-pyridin-2-yltriazol-1-yl)phenyl]phenyl] hypofluorite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[2,6-difluorooxy-4-(4-pyridin-2-yltriazol-1-yl)phenyl]phenyl] hypofluorite?
The IUPAC name of [4-[2,6-difluorooxy-4-(4-pyridin-2-yltriazol-1-yl)phenyl]phenyl] hypofluorite (CID 175061772) is [4-[2,6-difluorooxy-4-(4-pyridin-2-yltriazol-1-yl)phenyl]phenyl] hypofluorite.
What is the SMILES notation for [4-[2,6-difluorooxy-4-(4-pyridin-2-yltriazol-1-yl)phenyl]phenyl] hypofluorite?
The canonical SMILES for [4-[2,6-difluorooxy-4-(4-pyridin-2-yltriazol-1-yl)phenyl]phenyl] hypofluorite is FOc1ccc(-c2c(OF)cc(-n3cc(-c4ccccn4)nn3)cc2OF)cc1.
What is the InChIKey of [4-[2,6-difluorooxy-4-(4-pyridin-2-yltriazol-1-yl)phenyl]phenyl] hypofluorite?
The InChIKey is BECKHVRZCJHPHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H11F3N4O3/c20-27-14-6-4-12(5-7-14)19-17(28-21)9-13(10-18(19)29-22)26-11-16(24-25-26)15-3-1-2-8-23-15/h1-11H.
What are the key properties of [4-[2,6-difluorooxy-4-(4-pyridin-2-yltriazol-1-yl)phenyl]phenyl] hypofluorite?
[4-[2,6-difluorooxy-4-(4-pyridin-2-yltriazol-1-yl)phenyl]phenyl] hypofluorite has a molecular weight of 400.32 g/mol, XLogP of 4.79, 6 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[2,6-difluorooxy-4-(4-pyridin-2-yltriazol-1-yl)phenyl]phenyl] hypofluorite is sourced from PubChem (CID 175061772), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).