C13H14N4O2S — CID 175069307
1-benzamido-1-(4,5-dimethyl-1,3-thiazol-2-yl)urea (PubChem CID 175069307) has the molecular formula C13H14N4O2S and a molecular weight of 290.35 g/mol. Its IUPAC name is 1-benzamido-1-(4,5-dimethyl-1,3-thiazol-2-yl)urea.
| Compound Name | 1-benzamido-1-(4,5-dimethyl-1,3-thiazol-2-yl)urea |
|---|---|
| PubChem CID | 175069307 |
| Molecular Formula | C13H14N4O2S |
| Molecular Weight | 290.35 g/mol |
| Exact Mass | 290.08 |
| IUPAC Name | 1-benzamido-1-(4,5-dimethyl-1,3-thiazol-2-yl)urea |
| SMILES | Cc1nc(N(NC(=O)c2ccccc2)C(N)=O)sc1C |
| InChI | InChI=1S/C13H14N4O2S/c1-8-9(2)20-13(15-8)17(12(14)19)16-11(18)10-6-4-3-5-7-10/h3-7H,1-2H3,(H2,14,19)(H,16,18) |
| InChIKey | QMVDDVDOAVMRPK-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.35 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|