C12H10N4O6S — CID 175082935
2-(3,4-dinitrophenyl)sulfonylbenzene-1,3-diamine (PubChem CID 175082935) has the molecular formula C12H10N4O6S and a molecular weight of 338.30 g/mol. Its IUPAC name is 2-(3,4-dinitrophenyl)sulfonylbenzene-1,3-diamine.
| Compound Name | 2-(3,4-dinitrophenyl)sulfonylbenzene-1,3-diamine |
|---|---|
| PubChem CID | 175082935 |
| Molecular Formula | C12H10N4O6S |
| Molecular Weight | 338.30 g/mol |
| Exact Mass | 338.03 |
| IUPAC Name | 2-(3,4-dinitrophenyl)sulfonylbenzene-1,3-diamine |
| SMILES | Nc1cccc(N)c1S(=O)(=O)c1ccc([N+](=O)[O-])c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C12H10N4O6S/c13-8-2-1-3-9(14)12(8)23(21,22)7-4-5-10(15(17)18)11(6-7)16(19)20/h1-6H,13-14H2 |
| InChIKey | BQENHWXLSHCIAD-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 172.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.30 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|