C23H24N6O5 — CID 175094594
6,7-bis(2-methoxyethoxy)-N-[3-(triazol-1-yl)phenyl]quinazoline-4-carboxamide (PubChem CID 175094594) has the molecular formula C23H24N6O5 and a molecular weight of 464.48 g/mol. Its IUPAC name is 6,7-bis(2-methoxyethoxy)-N-[3-(triazol-1-yl)phenyl]quinazoline-4-carboxamide.
| Compound Name | 6,7-bis(2-methoxyethoxy)-N-[3-(triazol-1-yl)phenyl]quinazoline-4-carboxamide |
|---|---|
| PubChem CID | 175094594 |
| Molecular Formula | C23H24N6O5 |
| Molecular Weight | 464.48 g/mol |
| Exact Mass | 464.18 |
| IUPAC Name | 6,7-bis(2-methoxyethoxy)-N-[3-(triazol-1-yl)phenyl]quinazoline-4-carboxamide |
| SMILES | COCCOc1cc2ncnc(C(=O)Nc3cccc(-n4ccnn4)c3)c2cc1OCCOC |
| InChI | InChI=1S/C23H24N6O5/c1-31-8-10-33-20-13-18-19(14-21(20)34-11-9-32-2)24-15-25-22(18)23(30)27-16-4-3-5-17(12-16)29-7-6-26-28-29/h3-7,12-15H,8-11H2,1-2H3,(H,27,30) |
| InChIKey | LPUSHRZQQNSAJO-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 122.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.48 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|