C29H28N6O7 — CID 165151788
5-[4-[3-[[6,7-bis(2-methoxyethoxy)quinazolin-4-yl]amino]phenyl]triazol-1-yl]-2-hydroxybenzoic acid (PubChem CID 165151788) has the molecular formula C29H28N6O7 and a molecular weight of 572.58 g/mol. Its IUPAC name is 5-[4-[3-[[6,7-bis(2-methoxyethoxy)quinazolin-4-yl]amino]phenyl]triazol-1-yl]-2-hydroxybenzoic acid.
| Compound Name | 5-[4-[3-[[6,7-bis(2-methoxyethoxy)quinazolin-4-yl]amino]phenyl]triazol-1-yl]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 165151788 |
| Molecular Formula | C29H28N6O7 |
| Molecular Weight | 572.58 g/mol |
| Exact Mass | 572.20 |
| IUPAC Name | 5-[4-[3-[[6,7-bis(2-methoxyethoxy)quinazolin-4-yl]amino]phenyl]triazol-1-yl]-2-hydroxybenzoic acid |
| SMILES | COCCOc1cc2ncnc(Nc3cccc(-c4cn(-c5ccc(O)c(C(=O)O)c5)nn4)c3)c2cc1OCCOC |
| InChI | InChI=1S/C29H28N6O7/c1-39-8-10-41-26-14-21-23(15-27(26)42-11-9-40-2)30-17-31-28(21)32-19-5-3-4-18(12-19)24-16-35(34-33-24)20-6-7-25(36)22(13-20)29(37)38/h3-7,12-17,36H,8-11H2,1-2H3,(H,37,38)(H,30,31,32) |
| InChIKey | QIMONAZCNANGJD-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 162.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.58 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|