C11H15NO2S — CID 175111573
2-[2-[(5-ethynylthiophen-2-yl)-methylamino]ethoxy]ethanol (PubChem CID 175111573) has the molecular formula C11H15NO2S and a molecular weight of 225.31 g/mol. Its IUPAC name is 2-[2-[(5-ethynylthiophen-2-yl)-methylamino]ethoxy]ethanol.
| Compound Name | 2-[2-[(5-ethynylthiophen-2-yl)-methylamino]ethoxy]ethanol |
|---|---|
| PubChem CID | 175111573 |
| Molecular Formula | C11H15NO2S |
| Molecular Weight | 225.31 g/mol |
| Exact Mass | 225.08 |
| IUPAC Name | 2-[2-[(5-ethynylthiophen-2-yl)-methylamino]ethoxy]ethanol |
| SMILES | C#Cc1ccc(N(C)CCOCCO)s1 |
| InChI | InChI=1S/C11H15NO2S/c1-3-10-4-5-11(15-10)12(2)6-8-14-9-7-13/h1,4-5,13H,6-9H2,2H3 |
| InChIKey | KILKEMNKGJCGRI-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.31 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|