C29H34FN3O6 — CID 175123407
1-[6-fluoro-7-(4-methylpiperazin-1-yl)-1-oxido-8-propan-2-yloxyquinolin-1-ium-3-yl]-3-(3,4,5-trimethoxyphenyl)prop-2-en-1-one (PubChem CID 175123407) has the molecular formula C29H34FN3O6 and a molecular weight of 539.60 g/mol. Its IUPAC name is 1-[6-fluoro-7-(4-methylpiperazin-1-yl)-1-oxido-8-propan-2-yloxyquinolin-1-ium-3-yl]-3-(3,4,5-trimethoxyphenyl)prop-2-en-1-one.
| Compound Name | 1-[6-fluoro-7-(4-methylpiperazin-1-yl)-1-oxido-8-propan-2-yloxyquinolin-1-ium-3-yl]-3-(3,4,5-trimethoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 175123407 |
| Molecular Formula | C29H34FN3O6 |
| Molecular Weight | 539.60 g/mol |
| Exact Mass | 539.24 |
| IUPAC Name | 1-[6-fluoro-7-(4-methylpiperazin-1-yl)-1-oxido-8-propan-2-yloxyquinolin-1-ium-3-yl]-3-(3,4,5-trimethoxyphenyl)prop-2-en-1-one |
| SMILES | COc1cc(C=CC(=O)c2cc3cc(F)c(N4CCN(C)CC4)c(OC(C)C)c3[n+]([O-])c2)cc(OC)c1OC |
| InChI | InChI=1S/C29H34FN3O6/c1-18(2)39-29-26-20(16-22(30)27(29)32-11-9-31(3)10-12-32)15-21(17-33(26)35)23(34)8-7-19-13-24(36-4)28(38-6)25(14-19)37-5/h7-8,13-18H,9-12H2,1-6H3 |
| InChIKey | DTUPOAYOZQAGQJ-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 87.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.60 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|