C8H16N2O7P+ — CID 175137539
bis[2-(2-hydroxyethylamino)-2-oxoethoxy]-oxophosphanium (PubChem CID 175137539) has the molecular formula C8H16N2O7P+ and a molecular weight of 283.20 g/mol. Its IUPAC name is bis[2-(2-hydroxyethylamino)-2-oxoethoxy]-oxophosphanium.
| Compound Name | bis[2-(2-hydroxyethylamino)-2-oxoethoxy]-oxophosphanium |
|---|---|
| PubChem CID | 175137539 |
| Molecular Formula | C8H16N2O7P+ |
| Molecular Weight | 283.20 g/mol |
| Exact Mass | 283.07 |
| IUPAC Name | bis[2-(2-hydroxyethylamino)-2-oxoethoxy]-oxophosphanium |
| SMILES | O=C(CO[P+](=O)OCC(=O)NCCO)NCCO |
| InChI | InChI=1S/C8H15N2O7P/c11-3-1-9-7(13)5-16-18(15)17-6-8(14)10-2-4-12/h11-12H,1-6H2,(H-,9,10,13,14)/p+1 |
| InChIKey | CHIGIDKMBUATHE-UHFFFAOYSA-O |
| XLogP | -2.11 |
| TPSA | 134.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.20 |
| LogP ≤ 5 | -2.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|