C18H22BFN2O5S — CID 175145111
4-fluoro-N-[3-methoxy-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]benzenesulfonamide (PubChem CID 175145111) has the molecular formula C18H22BFN2O5S and a molecular weight of 408.26 g/mol. Its IUPAC name is 4-fluoro-N-[3-methoxy-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]benzenesulfonamide.
| Compound Name | 4-fluoro-N-[3-methoxy-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]benzenesulfonamide |
|---|---|
| PubChem CID | 175145111 |
| Molecular Formula | C18H22BFN2O5S |
| Molecular Weight | 408.26 g/mol |
| Exact Mass | 408.13 |
| IUPAC Name | 4-fluoro-N-[3-methoxy-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]benzenesulfonamide |
| SMILES | COc1ccc(B2OC(C)(C)C(C)(C)O2)nc1NS(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C18H22BFN2O5S/c1-17(2)18(3,4)27-19(26-17)15-11-10-14(25-5)16(21-15)22-28(23,24)13-8-6-12(20)7-9-13/h6-11H,1-5H3,(H,21,22) |
| InChIKey | LCIGZRSLXIXAEU-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 86.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.26 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|