C12H8F2O4 — CID 175145490
2-(3,3-difluoro-2,2-dihydroxynaphthalen-1-yl)-2-oxoacetaldehyde (PubChem CID 175145490) has the molecular formula C12H8F2O4 and a molecular weight of 254.19 g/mol. Its IUPAC name is 2-(3,3-difluoro-2,2-dihydroxynaphthalen-1-yl)-2-oxoacetaldehyde.
| Compound Name | 2-(3,3-difluoro-2,2-dihydroxynaphthalen-1-yl)-2-oxoacetaldehyde |
|---|---|
| PubChem CID | 175145490 |
| Molecular Formula | C12H8F2O4 |
| Molecular Weight | 254.19 g/mol |
| Exact Mass | 254.04 |
| IUPAC Name | 2-(3,3-difluoro-2,2-dihydroxynaphthalen-1-yl)-2-oxoacetaldehyde |
| SMILES | O=CC(=O)C1=c2ccccc2=CC(F)(F)C1(O)O |
| InChI | InChI=1S/C12H8F2O4/c13-11(14)5-7-3-1-2-4-8(7)10(9(16)6-15)12(11,17)18/h1-6,17-18H |
| InChIKey | PGXVMVCIMAGAQQ-UHFFFAOYSA-N |
| XLogP | -1.28 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.19 |
| LogP ≤ 5 | -1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|