C10H5F4NO2 — CID 174615814
2-oxo-2-(1,2,3,3-tetrafluoroisoindol-1-yl)acetaldehyde (PubChem CID 174615814) has the molecular formula C10H5F4NO2 and a molecular weight of 247.15 g/mol. Its IUPAC name is 2-oxo-2-(1,2,3,3-tetrafluoroisoindol-1-yl)acetaldehyde.
| Compound Name | 2-oxo-2-(1,2,3,3-tetrafluoroisoindol-1-yl)acetaldehyde |
|---|---|
| PubChem CID | 174615814 |
| Molecular Formula | C10H5F4NO2 |
| Molecular Weight | 247.15 g/mol |
| Exact Mass | 247.03 |
| IUPAC Name | 2-oxo-2-(1,2,3,3-tetrafluoroisoindol-1-yl)acetaldehyde |
| SMILES | O=CC(=O)C1(F)c2ccccc2C(F)(F)N1F |
| InChI | InChI=1S/C10H5F4NO2/c11-9(8(17)5-16)6-3-1-2-4-7(6)10(12,13)15(9)14/h1-5H |
| InChIKey | ZXYQVUVKSNKATA-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.15 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|